C19H18ClN3OS — CID 4286455
4-(4-chlorophenyl)-3-[(4-ethoxyphenyl)methylideneamino]-N-methyl-1,3-thiazol-2-imine (PubChem CID 4286455) has the molecular formula C19H18ClN3OS and a molecular weight of 371.89 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-3-[(4-ethoxyphenyl)methylideneamino]-N-methyl-1,3-thiazol-2-imine.
| Compound Name | 4-(4-chlorophenyl)-3-[(4-ethoxyphenyl)methylideneamino]-N-methyl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 4286455 |
| Molecular Formula | C19H18ClN3OS |
| Molecular Weight | 371.89 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | 4-(4-chlorophenyl)-3-[(4-ethoxyphenyl)methylideneamino]-N-methyl-1,3-thiazol-2-imine |
| SMILES | CCOc1ccc(C=Nn2c(-c3ccc(Cl)cc3)cs/c2=N\C)cc1 |
| InChI | InChI=1S/C19H18ClN3OS/c1-3-24-17-10-4-14(5-11-17)12-22-23-18(13-25-19(23)21-2)15-6-8-16(20)9-7-15/h4-13H,3H2,1-2H3/b21-19-,22-12? |
| InChIKey | NNABGTCSKOJQRI-UCTLZQNBSA-N |
| XLogP | 4.68 |
| TPSA | 38.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.89 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|