C19H15BrN4O3S — CID 135841010
4-bromo-2-[[4-(4-nitrophenyl)-2-prop-2-enylimino-1,3-thiazol-3-yl]iminomethyl]phenol (PubChem CID 135841010) has the molecular formula C19H15BrN4O3S and a molecular weight of 459.33 g/mol. Its IUPAC name is 4-bromo-2-[[4-(4-nitrophenyl)-2-prop-2-enylimino-1,3-thiazol-3-yl]iminomethyl]phenol.
| Compound Name | 4-bromo-2-[[4-(4-nitrophenyl)-2-prop-2-enylimino-1,3-thiazol-3-yl]iminomethyl]phenol |
|---|---|
| PubChem CID | 135841010 |
| Molecular Formula | C19H15BrN4O3S |
| Molecular Weight | 459.33 g/mol |
| Exact Mass | 458.00 |
| IUPAC Name | 4-bromo-2-[[4-(4-nitrophenyl)-2-prop-2-enylimino-1,3-thiazol-3-yl]iminomethyl]phenol |
| SMILES | C=CC/N=c1\scc(-c2ccc([N+](=O)[O-])cc2)n1N=Cc1cc(Br)ccc1O |
| InChI | InChI=1S/C19H15BrN4O3S/c1-2-9-21-19-23(22-11-14-10-15(20)5-8-18(14)25)17(12-28-19)13-3-6-16(7-4-13)24(26)27/h2-8,10-12,25H,1,9H2/b21-19-,22-11? |
| InChIKey | FIDLHRVSVYQSEU-VXVAVIQKSA-N |
| XLogP | 4.56 |
| TPSA | 93.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.33 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|