C25H27N3O3S — CID 135713289
4-[[4-(4-cyclohexylphenyl)-2-prop-2-enylimino-1,3-thiazol-3-yl]iminomethyl]benzene-1,2,3-triol (PubChem CID 135713289) has the molecular formula C25H27N3O3S and a molecular weight of 449.58 g/mol. Its IUPAC name is 4-[[4-(4-cyclohexylphenyl)-2-prop-2-enylimino-1,3-thiazol-3-yl]iminomethyl]benzene-1,2,3-triol.
| Compound Name | 4-[[4-(4-cyclohexylphenyl)-2-prop-2-enylimino-1,3-thiazol-3-yl]iminomethyl]benzene-1,2,3-triol |
|---|---|
| PubChem CID | 135713289 |
| Molecular Formula | C25H27N3O3S |
| Molecular Weight | 449.58 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | 4-[[4-(4-cyclohexylphenyl)-2-prop-2-enylimino-1,3-thiazol-3-yl]iminomethyl]benzene-1,2,3-triol |
| SMILES | C=CC/N=c1\scc(-c2ccc(C3CCCCC3)cc2)n1N=Cc1ccc(O)c(O)c1O |
| InChI | InChI=1S/C25H27N3O3S/c1-2-14-26-25-28(27-15-20-12-13-22(29)24(31)23(20)30)21(16-32-25)19-10-8-18(9-11-19)17-6-4-3-5-7-17/h2,8-13,15-17,29-31H,1,3-7,14H2/b26-25-,27-15? |
| InChIKey | QLEGVKXHUAVZCG-CCIWYEMLSA-N |
| XLogP | 5.35 |
| TPSA | 90.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.58 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|