C25H25ClN4O3S — CID 135575417
4-chloro-2-[[4-(4-cyclohexylphenyl)-2-prop-2-enylimino-1,3-thiazol-3-yl]iminomethyl]-6-nitrophenol (PubChem CID 135575417) has the molecular formula C25H25ClN4O3S and a molecular weight of 497.02 g/mol. Its IUPAC name is 4-chloro-2-[[4-(4-cyclohexylphenyl)-2-prop-2-enylimino-1,3-thiazol-3-yl]iminomethyl]-6-nitrophenol.
| Compound Name | 4-chloro-2-[[4-(4-cyclohexylphenyl)-2-prop-2-enylimino-1,3-thiazol-3-yl]iminomethyl]-6-nitrophenol |
|---|---|
| PubChem CID | 135575417 |
| Molecular Formula | C25H25ClN4O3S |
| Molecular Weight | 497.02 g/mol |
| Exact Mass | 496.13 |
| IUPAC Name | 4-chloro-2-[[4-(4-cyclohexylphenyl)-2-prop-2-enylimino-1,3-thiazol-3-yl]iminomethyl]-6-nitrophenol |
| SMILES | C=CC/N=c1\scc(-c2ccc(C3CCCCC3)cc2)n1N=Cc1cc(Cl)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C25H25ClN4O3S/c1-2-12-27-25-29(28-15-20-13-21(26)14-22(24(20)31)30(32)33)23(16-34-25)19-10-8-18(9-11-19)17-6-4-3-5-7-17/h2,8-11,13-17,31H,1,3-7,12H2/b27-25-,28-15? |
| InChIKey | TXZPYHATMDENPS-RHNMIWPKSA-N |
| XLogP | 6.50 |
| TPSA | 93.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.02 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|