C23H20Cl2N4O4S — CID 23852538
N-cyclohexyl-4-(3,4-dichlorophenyl)-3-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-1,3-thiazol-2-imine (PubChem CID 23852538) has the molecular formula C23H20Cl2N4O4S and a molecular weight of 519.41 g/mol. Its IUPAC name is N-cyclohexyl-4-(3,4-dichlorophenyl)-3-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-1,3-thiazol-2-imine.
| Compound Name | N-cyclohexyl-4-(3,4-dichlorophenyl)-3-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23852538 |
| Molecular Formula | C23H20Cl2N4O4S |
| Molecular Weight | 519.41 g/mol |
| Exact Mass | 518.06 |
| IUPAC Name | N-cyclohexyl-4-(3,4-dichlorophenyl)-3-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-1,3-thiazol-2-imine |
| SMILES | O=[N+]([O-])c1cc2c(cc1C=Nn1c(-c3ccc(Cl)c(Cl)c3)cs/c1=N\C1CCCCC1)OCO2 |
| InChI | InChI=1S/C23H20Cl2N4O4S/c24-17-7-6-14(8-18(17)25)20-12-34-23(27-16-4-2-1-3-5-16)28(20)26-11-15-9-21-22(33-13-32-21)10-19(15)29(30)31/h6-12,16H,1-5,13H2/b26-11?,27-23- |
| InChIKey | NDBUODPBORQKIS-FYMMVRAUSA-N |
| XLogP | 6.28 |
| TPSA | 91.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.41 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|