C19H14F2N4O5S — CID 6905517
(E)-4-[4-(difluoromethoxy)phenyl]-N-methyl-3-[(E)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-1,3-thiazol-2-imine (PubChem CID 6905517) has the molecular formula C19H14F2N4O5S and a molecular weight of 448.41 g/mol. Its IUPAC name is (E)-4-[4-(difluoromethoxy)phenyl]-N-methyl-3-[(E)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-1,3-thiazol-2-imine.
| Compound Name | (E)-4-[4-(difluoromethoxy)phenyl]-N-methyl-3-[(E)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 6905517 |
| Molecular Formula | C19H14F2N4O5S |
| Molecular Weight | 448.41 g/mol |
| Exact Mass | 448.07 |
| IUPAC Name | (E)-4-[4-(difluoromethoxy)phenyl]-N-methyl-3-[(E)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-1,3-thiazol-2-imine |
| SMILES | C/N=c1\scc(-c2ccc(OC(F)F)cc2)n1/N=C/c1cc2c(cc1[N+](=O)[O-])OCO2 |
| InChI | InChI=1S/C19H14F2N4O5S/c1-22-19-24(15(9-31-19)11-2-4-13(5-3-11)30-18(20)21)23-8-12-6-16-17(29-10-28-16)7-14(12)25(26)27/h2-9,18H,10H2,1H3/b22-19-,23-8+ |
| InChIKey | MINRNADOXMLHGW-IAYRYLBSSA-N |
| XLogP | 3.87 |
| TPSA | 100.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.41 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|