C25H19N5O8S — CID 23850523
4-(2,5-dimethoxyphenyl)-3-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-N-(2-nitrophenyl)-1,3-thiazol-2-imine (PubChem CID 23850523) has the molecular formula C25H19N5O8S and a molecular weight of 549.52 g/mol. Its IUPAC name is 4-(2,5-dimethoxyphenyl)-3-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-N-(2-nitrophenyl)-1,3-thiazol-2-imine.
| Compound Name | 4-(2,5-dimethoxyphenyl)-3-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-N-(2-nitrophenyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23850523 |
| Molecular Formula | C25H19N5O8S |
| Molecular Weight | 549.52 g/mol |
| Exact Mass | 549.10 |
| IUPAC Name | 4-(2,5-dimethoxyphenyl)-3-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-N-(2-nitrophenyl)-1,3-thiazol-2-imine |
| SMILES | COc1ccc(OC)c(-c2cs/c(=N\c3ccccc3[N+](=O)[O-])n2N=Cc2cc3c(cc2[N+](=O)[O-])OCO3)c1 |
| InChI | InChI=1S/C25H19N5O8S/c1-35-16-7-8-22(36-2)17(10-16)21-13-39-25(27-18-5-3-4-6-19(18)29(31)32)28(21)26-12-15-9-23-24(38-14-37-23)11-20(15)30(33)34/h3-13H,14H2,1-2H3/b26-12?,27-25- |
| InChIKey | OSQMRMHMAOMGKC-AKOWFRQXSA-N |
| XLogP | 4.89 |
| TPSA | 152.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.52 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|