C27H24N4O4S — CID 23903094
4-(2,5-dimethoxyphenyl)-3-[2-(1H-indol-3-yl)ethyl]-N-(2-nitrophenyl)-1,3-thiazol-2-imine (PubChem CID 23903094) has the molecular formula C27H24N4O4S and a molecular weight of 500.58 g/mol. Its IUPAC name is 4-(2,5-dimethoxyphenyl)-3-[2-(1H-indol-3-yl)ethyl]-N-(2-nitrophenyl)-1,3-thiazol-2-imine.
| Compound Name | 4-(2,5-dimethoxyphenyl)-3-[2-(1H-indol-3-yl)ethyl]-N-(2-nitrophenyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23903094 |
| Molecular Formula | C27H24N4O4S |
| Molecular Weight | 500.58 g/mol |
| Exact Mass | 500.15 |
| IUPAC Name | 4-(2,5-dimethoxyphenyl)-3-[2-(1H-indol-3-yl)ethyl]-N-(2-nitrophenyl)-1,3-thiazol-2-imine |
| SMILES | COc1ccc(OC)c(-c2cs/c(=N\c3ccccc3[N+](=O)[O-])n2CCc2c[nH]c3ccccc23)c1 |
| InChI | InChI=1S/C27H24N4O4S/c1-34-19-11-12-26(35-2)21(15-19)25-17-36-27(29-23-9-5-6-10-24(23)31(32)33)30(25)14-13-18-16-28-22-8-4-3-7-20(18)22/h3-12,15-17,28H,13-14H2,1-2H3/b29-27- |
| InChIKey | ZBWWCIVXVIEEGG-OHYPFYFLSA-N |
| XLogP | 6.10 |
| TPSA | 94.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.58 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|