C21H21N3O2S — CID 11317125
4-(2,5-dimethoxyphenyl)-N-[2-(1H-indol-3-yl)ethyl]-1,3-thiazol-2-amine (PubChem CID 11317125) has the molecular formula C21H21N3O2S and a molecular weight of 379.49 g/mol. Its IUPAC name is 4-(2,5-dimethoxyphenyl)-N-[2-(1H-indol-3-yl)ethyl]-1,3-thiazol-2-amine.
| Compound Name | 4-(2,5-dimethoxyphenyl)-N-[2-(1H-indol-3-yl)ethyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 11317125 |
| Molecular Formula | C21H21N3O2S |
| Molecular Weight | 379.49 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | 4-(2,5-dimethoxyphenyl)-N-[2-(1H-indol-3-yl)ethyl]-1,3-thiazol-2-amine |
| SMILES | COc1ccc(OC)c(-c2csc(NCCc3c[nH]c4ccccc34)n2)c1 |
| InChI | InChI=1S/C21H21N3O2S/c1-25-15-7-8-20(26-2)17(11-15)19-13-27-21(24-19)22-10-9-14-12-23-18-6-4-3-5-16(14)18/h3-8,11-13,23H,9-10H2,1-2H3,(H,22,24) |
| InChIKey | BJXISZAJGXXAII-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 59.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.49 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |