C20H17N3O2S — CID 8839526
N-[4-(1H-indol-3-yl)-1,3-thiazol-2-yl]-2-(2-methoxyphenyl)acetamide (PubChem CID 8839526) has the molecular formula C20H17N3O2S and a molecular weight of 363.44 g/mol. Its IUPAC name is N-[4-(1H-indol-3-yl)-1,3-thiazol-2-yl]-2-(2-methoxyphenyl)acetamide.
| Compound Name | N-[4-(1H-indol-3-yl)-1,3-thiazol-2-yl]-2-(2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 8839526 |
| Molecular Formula | C20H17N3O2S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | N-[4-(1H-indol-3-yl)-1,3-thiazol-2-yl]-2-(2-methoxyphenyl)acetamide |
| SMILES | COc1ccccc1CC(=O)Nc1nc(-c2c[nH]c3ccccc23)cs1 |
| InChI | InChI=1S/C20H17N3O2S/c1-25-18-9-5-2-6-13(18)10-19(24)23-20-22-17(12-26-20)15-11-21-16-8-4-3-7-14(15)16/h2-9,11-12,21H,10H2,1H3,(H,22,23,24) |
| InChIKey | PHWYOMISAOCZKP-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |