C18H20N4O2S — CID 31510372
(2R)-2-acetamido-N-[4-(1H-indol-3-yl)-1,3-thiazol-2-yl]-3-methylbutanamide (PubChem CID 31510372) has the molecular formula C18H20N4O2S and a molecular weight of 356.45 g/mol. Its IUPAC name is (2R)-2-acetamido-N-[4-(1H-indol-3-yl)-1,3-thiazol-2-yl]-3-methylbutanamide.
| Compound Name | (2R)-2-acetamido-N-[4-(1H-indol-3-yl)-1,3-thiazol-2-yl]-3-methylbutanamide |
|---|---|
| PubChem CID | 31510372 |
| Molecular Formula | C18H20N4O2S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | (2R)-2-acetamido-N-[4-(1H-indol-3-yl)-1,3-thiazol-2-yl]-3-methylbutanamide |
| SMILES | CC(=O)N[C@@H](C(=O)Nc1nc(-c2c[nH]c3ccccc23)cs1)C(C)C |
| InChI | InChI=1S/C18H20N4O2S/c1-10(2)16(20-11(3)23)17(24)22-18-21-15(9-25-18)13-8-19-14-7-5-4-6-12(13)14/h4-10,16,19H,1-3H3,(H,20,23)(H,21,22,24)/t16-/m1/s1 |
| InChIKey | DBDURUBJDUUBQX-MRXNPFEDSA-N |
| XLogP | 3.39 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |