C21H20N4OS — CID 167861370
3-[(dimethylamino)methyl]-N-[4-(1H-indol-3-yl)-1,3-thiazol-2-yl]benzamide (PubChem CID 167861370) has the molecular formula C21H20N4OS and a molecular weight of 376.49 g/mol. Its IUPAC name is 3-[(dimethylamino)methyl]-N-[4-(1H-indol-3-yl)-1,3-thiazol-2-yl]benzamide.
| Compound Name | 3-[(dimethylamino)methyl]-N-[4-(1H-indol-3-yl)-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 167861370 |
| Molecular Formula | C21H20N4OS |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 3-[(dimethylamino)methyl]-N-[4-(1H-indol-3-yl)-1,3-thiazol-2-yl]benzamide |
| SMILES | CN(C)Cc1cccc(C(=O)Nc2nc(-c3c[nH]c4ccccc34)cs2)c1 |
| InChI | InChI=1S/C21H20N4OS/c1-25(2)12-14-6-5-7-15(10-14)20(26)24-21-23-19(13-27-21)17-11-22-18-9-4-3-8-16(17)18/h3-11,13,22H,12H2,1-2H3,(H,23,24,26) |
| InChIKey | QPTOGNWVEGKVKX-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |