C19H14N4O3S — CID 26208885
N-[4-(1H-indol-3-yl)-1,3-thiazol-2-yl]-4-methyl-3-nitrobenzamide (PubChem CID 26208885) has the molecular formula C19H14N4O3S and a molecular weight of 378.41 g/mol. Its IUPAC name is N-[4-(1H-indol-3-yl)-1,3-thiazol-2-yl]-4-methyl-3-nitrobenzamide.
| Compound Name | N-[4-(1H-indol-3-yl)-1,3-thiazol-2-yl]-4-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 26208885 |
| Molecular Formula | C19H14N4O3S |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | N-[4-(1H-indol-3-yl)-1,3-thiazol-2-yl]-4-methyl-3-nitrobenzamide |
| SMILES | Cc1ccc(C(=O)Nc2nc(-c3c[nH]c4ccccc34)cs2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H14N4O3S/c1-11-6-7-12(8-17(11)23(25)26)18(24)22-19-21-16(10-27-19)14-9-20-15-5-3-2-4-13(14)15/h2-10,20H,1H3,(H,21,22,24) |
| InChIKey | JUHYTQIQVAVCHF-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 100.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|