C15H12N4O3S — CID 94134950
cis-(1R,2S)-N-[4-(1H-indol-3-yl)-1,3-thiazol-2-yl]-2-nitrocyclopropane-1-carboxamide (PubChem CID 94134950) has the molecular formula C15H12N4O3S and a molecular weight of 328.35 g/mol. Its IUPAC name is cis-(1R,2S)-N-[4-(1H-indol-3-yl)-1,3-thiazol-2-yl]-2-nitrocyclopropane-1-carboxamide.
| Compound Name | cis-(1R,2S)-N-[4-(1H-indol-3-yl)-1,3-thiazol-2-yl]-2-nitrocyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 94134950 |
| Molecular Formula | C15H12N4O3S |
| Molecular Weight | 328.35 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | cis-(1R,2S)-N-[4-(1H-indol-3-yl)-1,3-thiazol-2-yl]-2-nitrocyclopropane-1-carboxamide |
| SMILES | O=C(Nc1nc(-c2c[nH]c3ccccc23)cs1)[C@@H]1C[C@@H]1[N+](=O)[O-] |
| InChI | InChI=1S/C15H12N4O3S/c20-14(9-5-13(9)19(21)22)18-15-17-12(7-23-15)10-6-16-11-4-2-1-3-8(10)11/h1-4,6-7,9,13,16H,5H2,(H,17,18,20)/t9-,13+/m1/s1 |
| InChIKey | GMUTYZBQMALXRT-RNCFNFMXSA-N |
| XLogP | 2.90 |
| TPSA | 100.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.35 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|