C25H18Cl2N4O2S — CID 23932303
N-(2,4-dichlorophenyl)-3-[2-(1H-indol-3-yl)ethyl]-4-(4-nitrophenyl)-1,3-thiazol-2-imine (PubChem CID 23932303) has the molecular formula C25H18Cl2N4O2S and a molecular weight of 509.42 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-3-[2-(1H-indol-3-yl)ethyl]-4-(4-nitrophenyl)-1,3-thiazol-2-imine.
| Compound Name | N-(2,4-dichlorophenyl)-3-[2-(1H-indol-3-yl)ethyl]-4-(4-nitrophenyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23932303 |
| Molecular Formula | C25H18Cl2N4O2S |
| Molecular Weight | 509.42 g/mol |
| Exact Mass | 508.05 |
| IUPAC Name | N-(2,4-dichlorophenyl)-3-[2-(1H-indol-3-yl)ethyl]-4-(4-nitrophenyl)-1,3-thiazol-2-imine |
| SMILES | O=[N+]([O-])c1ccc(-c2cs/c(=N\c3ccc(Cl)cc3Cl)n2CCc2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C25H18Cl2N4O2S/c26-18-7-10-23(21(27)13-18)29-25-30(12-11-17-14-28-22-4-2-1-3-20(17)22)24(15-34-25)16-5-8-19(9-6-16)31(32)33/h1-10,13-15,28H,11-12H2/b29-25- |
| InChIKey | RMVODLNZLFWGEU-GNVQSUKOSA-N |
| XLogP | 7.39 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.42 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|