C20H18ClN3S — CID 4874426
3-[2-(5-chloro-1H-indol-3-yl)ethyl]-N-methyl-4-phenyl-1,3-thiazol-2-imine (PubChem CID 4874426) has the molecular formula C20H18ClN3S and a molecular weight of 367.91 g/mol. Its IUPAC name is 3-[2-(5-chloro-1H-indol-3-yl)ethyl]-N-methyl-4-phenyl-1,3-thiazol-2-imine.
| Compound Name | 3-[2-(5-chloro-1H-indol-3-yl)ethyl]-N-methyl-4-phenyl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 4874426 |
| Molecular Formula | C20H18ClN3S |
| Molecular Weight | 367.91 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | 3-[2-(5-chloro-1H-indol-3-yl)ethyl]-N-methyl-4-phenyl-1,3-thiazol-2-imine |
| SMILES | C/N=c1\scc(-c2ccccc2)n1CCc1c[nH]c2ccc(Cl)cc12 |
| InChI | InChI=1S/C20H18ClN3S/c1-22-20-24(19(13-25-20)14-5-3-2-4-6-14)10-9-15-12-23-18-8-7-16(21)11-17(15)18/h2-8,11-13,23H,9-10H2,1H3/b22-20- |
| InChIKey | OYSIYYLSQCFWAA-XDOYNYLZSA-N |
| XLogP | 5.12 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.91 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|