C25H26ClN3S — CID 4874429
3-[2-(5-chloro-1H-indol-3-yl)ethyl]-N-cyclohexyl-4-phenyl-1,3-thiazol-2-imine (PubChem CID 4874429) has the molecular formula C25H26ClN3S and a molecular weight of 436.02 g/mol. Its IUPAC name is 3-[2-(5-chloro-1H-indol-3-yl)ethyl]-N-cyclohexyl-4-phenyl-1,3-thiazol-2-imine.
| Compound Name | 3-[2-(5-chloro-1H-indol-3-yl)ethyl]-N-cyclohexyl-4-phenyl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 4874429 |
| Molecular Formula | C25H26ClN3S |
| Molecular Weight | 436.02 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | 3-[2-(5-chloro-1H-indol-3-yl)ethyl]-N-cyclohexyl-4-phenyl-1,3-thiazol-2-imine |
| SMILES | Clc1ccc2[nH]cc(CCn3c(-c4ccccc4)cs/c3=N\C3CCCCC3)c2c1 |
| InChI | InChI=1S/C25H26ClN3S/c26-20-11-12-23-22(15-20)19(16-27-23)13-14-29-24(18-7-3-1-4-8-18)17-30-25(29)28-21-9-5-2-6-10-21/h1,3-4,7-8,11-12,15-17,21,27H,2,5-6,9-10,13-14H2/b28-25- |
| InChIKey | UWCPGLDGFVSNBE-FVDSYPCUSA-N |
| XLogP | 6.83 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.02 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|