C27H29ClN4O2S — CID 4874415
2-[3-[2-(5-chloro-1H-indol-3-yl)ethyl]-2-cyclohexylimino-4-oxo-1,3-thiazolidin-5-yl]-N-phenylacetamide (PubChem CID 4874415) has the molecular formula C27H29ClN4O2S and a molecular weight of 509.08 g/mol. Its IUPAC name is 2-[3-[2-(5-chloro-1H-indol-3-yl)ethyl]-2-cyclohexylimino-4-oxo-1,3-thiazolidin-5-yl]-N-phenylacetamide.
| Compound Name | 2-[3-[2-(5-chloro-1H-indol-3-yl)ethyl]-2-cyclohexylimino-4-oxo-1,3-thiazolidin-5-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 4874415 |
| Molecular Formula | C27H29ClN4O2S |
| Molecular Weight | 509.08 g/mol |
| Exact Mass | 508.17 |
| IUPAC Name | 2-[3-[2-(5-chloro-1H-indol-3-yl)ethyl]-2-cyclohexylimino-4-oxo-1,3-thiazolidin-5-yl]-N-phenylacetamide |
| SMILES | O=C(CC1S/C(=N\C2CCCCC2)N(CCc2c[nH]c3ccc(Cl)cc23)C1=O)Nc1ccccc1 |
| InChI | InChI=1S/C27H29ClN4O2S/c28-19-11-12-23-22(15-19)18(17-29-23)13-14-32-26(34)24(16-25(33)30-20-7-3-1-4-8-20)35-27(32)31-21-9-5-2-6-10-21/h1,3-4,7-8,11-12,15,17,21,24,29H,2,5-6,9-10,13-14,16H2,(H,30,33)/b31-27- |
| InChIKey | KPLWKORIVJBRLF-QVTSOHHYSA-N |
| XLogP | 6.03 |
| TPSA | 77.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.08 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|