C19H24ClN3O3S — CID 1217522
N-(5-chloro-2-methoxyphenyl)-2-[(5R)-2-cyclohexylimino-3-methyl-4-oxo-1,3-thiazolidin-5-yl]acetamide (PubChem CID 1217522) has the molecular formula C19H24ClN3O3S and a molecular weight of 409.94 g/mol. Its IUPAC name is N-(5-chloro-2-methoxyphenyl)-2-[(5R)-2-cyclohexylimino-3-methyl-4-oxo-1,3-thiazolidin-5-yl]acetamide.
| Compound Name | N-(5-chloro-2-methoxyphenyl)-2-[(5R)-2-cyclohexylimino-3-methyl-4-oxo-1,3-thiazolidin-5-yl]acetamide |
|---|---|
| PubChem CID | 1217522 |
| Molecular Formula | C19H24ClN3O3S |
| Molecular Weight | 409.94 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | N-(5-chloro-2-methoxyphenyl)-2-[(5R)-2-cyclohexylimino-3-methyl-4-oxo-1,3-thiazolidin-5-yl]acetamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)C[C@H]1S/C(=N\C2CCCCC2)N(C)C1=O |
| InChI | InChI=1S/C19H24ClN3O3S/c1-23-18(25)16(27-19(23)21-13-6-4-3-5-7-13)11-17(24)22-14-10-12(20)8-9-15(14)26-2/h8-10,13,16H,3-7,11H2,1-2H3,(H,22,24)/b21-19-/t16-/m1/s1 |
| InChIKey | NTUZNLWQVXMXGE-BSBNDGSWSA-N |
| XLogP | 3.94 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.94 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|