C19H17Cl2N3O2S — CID 35177861
N-(2,5-dichlorophenyl)-2-[(5R)-3-methyl-2-(4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]acetamide (PubChem CID 35177861) has the molecular formula C19H17Cl2N3O2S and a molecular weight of 422.34 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)-2-[(5R)-3-methyl-2-(4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]acetamide.
| Compound Name | N-(2,5-dichlorophenyl)-2-[(5R)-3-methyl-2-(4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]acetamide |
|---|---|
| PubChem CID | 35177861 |
| Molecular Formula | C19H17Cl2N3O2S |
| Molecular Weight | 422.34 g/mol |
| Exact Mass | 421.04 |
| IUPAC Name | N-(2,5-dichlorophenyl)-2-[(5R)-3-methyl-2-(4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]acetamide |
| SMILES | Cc1ccc(/N=C2/S[C@H](CC(=O)Nc3cc(Cl)ccc3Cl)C(=O)N2C)cc1 |
| InChI | InChI=1S/C19H17Cl2N3O2S/c1-11-3-6-13(7-4-11)22-19-24(2)18(26)16(27-19)10-17(25)23-15-9-12(20)5-8-14(15)21/h3-9,16H,10H2,1-2H3,(H,23,25)/b22-19+/t16-/m1/s1 |
| InChIKey | MYHGVPNOJCIWER-UFIXSJTLSA-N |
| XLogP | 4.89 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.34 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|