C20H19Cl2N3O3S — CID 41244395
N-(3,5-dichlorophenyl)-2-[(5S)-2-(4-ethoxyphenyl)imino-3-methyl-4-oxo-1,3-thiazolidin-5-yl]acetamide (PubChem CID 41244395) has the molecular formula C20H19Cl2N3O3S and a molecular weight of 452.36 g/mol. Its IUPAC name is N-(3,5-dichlorophenyl)-2-[(5S)-2-(4-ethoxyphenyl)imino-3-methyl-4-oxo-1,3-thiazolidin-5-yl]acetamide.
| Compound Name | N-(3,5-dichlorophenyl)-2-[(5S)-2-(4-ethoxyphenyl)imino-3-methyl-4-oxo-1,3-thiazolidin-5-yl]acetamide |
|---|---|
| PubChem CID | 41244395 |
| Molecular Formula | C20H19Cl2N3O3S |
| Molecular Weight | 452.36 g/mol |
| Exact Mass | 451.05 |
| IUPAC Name | N-(3,5-dichlorophenyl)-2-[(5S)-2-(4-ethoxyphenyl)imino-3-methyl-4-oxo-1,3-thiazolidin-5-yl]acetamide |
| SMILES | CCOc1ccc(/N=C2/S[C@@H](CC(=O)Nc3cc(Cl)cc(Cl)c3)C(=O)N2C)cc1 |
| InChI | InChI=1S/C20H19Cl2N3O3S/c1-3-28-16-6-4-14(5-7-16)24-20-25(2)19(27)17(29-20)11-18(26)23-15-9-12(21)8-13(22)10-15/h4-10,17H,3,11H2,1-2H3,(H,23,26)/b24-20+/t17-/m0/s1 |
| InChIKey | YOJVUQPZFXSQPG-OVJLLXBISA-N |
| XLogP | 4.98 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.36 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|