C21H21Cl2N3O3S — CID 21368848
2-[2-(3,5-dichlorophenyl)imino-3-ethyl-4-oxo-1,3-thiazolidin-5-yl]-N-(4-ethoxyphenyl)acetamide (PubChem CID 21368848) has the molecular formula C21H21Cl2N3O3S and a molecular weight of 466.39 g/mol. Its IUPAC name is 2-[2-(3,5-dichlorophenyl)imino-3-ethyl-4-oxo-1,3-thiazolidin-5-yl]-N-(4-ethoxyphenyl)acetamide.
| Compound Name | 2-[2-(3,5-dichlorophenyl)imino-3-ethyl-4-oxo-1,3-thiazolidin-5-yl]-N-(4-ethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 21368848 |
| Molecular Formula | C21H21Cl2N3O3S |
| Molecular Weight | 466.39 g/mol |
| Exact Mass | 465.07 |
| IUPAC Name | 2-[2-(3,5-dichlorophenyl)imino-3-ethyl-4-oxo-1,3-thiazolidin-5-yl]-N-(4-ethoxyphenyl)acetamide |
| SMILES | CCOc1ccc(NC(=O)CC2S/C(=N\c3cc(Cl)cc(Cl)c3)N(CC)C2=O)cc1 |
| InChI | InChI=1S/C21H21Cl2N3O3S/c1-3-26-20(28)18(30-21(26)25-16-10-13(22)9-14(23)11-16)12-19(27)24-15-5-7-17(8-6-15)29-4-2/h5-11,18H,3-4,12H2,1-2H3,(H,24,27)/b25-21- |
| InChIKey | CXIDEUUPDDYCLE-DAFNUICNSA-N |
| XLogP | 5.37 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.39 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|