C19H16Cl2FN3O2S — CID 21368849
2-[2-(3,5-dichlorophenyl)imino-3-ethyl-4-oxo-1,3-thiazolidin-5-yl]-N-(2-fluorophenyl)acetamide (PubChem CID 21368849) has the molecular formula C19H16Cl2FN3O2S and a molecular weight of 440.33 g/mol. Its IUPAC name is 2-[2-(3,5-dichlorophenyl)imino-3-ethyl-4-oxo-1,3-thiazolidin-5-yl]-N-(2-fluorophenyl)acetamide.
| Compound Name | 2-[2-(3,5-dichlorophenyl)imino-3-ethyl-4-oxo-1,3-thiazolidin-5-yl]-N-(2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 21368849 |
| Molecular Formula | C19H16Cl2FN3O2S |
| Molecular Weight | 440.33 g/mol |
| Exact Mass | 439.03 |
| IUPAC Name | 2-[2-(3,5-dichlorophenyl)imino-3-ethyl-4-oxo-1,3-thiazolidin-5-yl]-N-(2-fluorophenyl)acetamide |
| SMILES | CCN1C(=O)C(CC(=O)Nc2ccccc2F)S/C1=N\c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C19H16Cl2FN3O2S/c1-2-25-18(27)16(10-17(26)24-15-6-4-3-5-14(15)22)28-19(25)23-13-8-11(20)7-12(21)9-13/h3-9,16H,2,10H2,1H3,(H,24,26)/b23-19- |
| InChIKey | MXRMKPFEISWCAP-NMWGTECJSA-N |
| XLogP | 5.11 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.33 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|