C22H24FN3O2S — CID 8715702
N-(2-fluorophenyl)-2-[(5S)-3-(3-methylbutyl)-4-oxo-2-phenylimino-1,3-thiazolidin-5-yl]acetamide (PubChem CID 8715702) has the molecular formula C22H24FN3O2S and a molecular weight of 413.52 g/mol. Its IUPAC name is N-(2-fluorophenyl)-2-[(5S)-3-(3-methylbutyl)-4-oxo-2-phenylimino-1,3-thiazolidin-5-yl]acetamide.
| Compound Name | N-(2-fluorophenyl)-2-[(5S)-3-(3-methylbutyl)-4-oxo-2-phenylimino-1,3-thiazolidin-5-yl]acetamide |
|---|---|
| PubChem CID | 8715702 |
| Molecular Formula | C22H24FN3O2S |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | N-(2-fluorophenyl)-2-[(5S)-3-(3-methylbutyl)-4-oxo-2-phenylimino-1,3-thiazolidin-5-yl]acetamide |
| SMILES | CC(C)CCN1C(=O)[C@H](CC(=O)Nc2ccccc2F)S/C1=N\c1ccccc1 |
| InChI | InChI=1S/C22H24FN3O2S/c1-15(2)12-13-26-21(28)19(29-22(26)24-16-8-4-3-5-9-16)14-20(27)25-18-11-7-6-10-17(18)23/h3-11,15,19H,12-14H2,1-2H3,(H,25,27)/b24-22-/t19-/m0/s1 |
| InChIKey | DZMPWCOKAHGKFC-COPMAWBXSA-N |
| XLogP | 4.83 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|