C23H27N3O2S — CID 8715739
2-[(5S)-3-(3-methylbutyl)-4-oxo-2-phenylimino-1,3-thiazolidin-5-yl]-N-(2-methylphenyl)acetamide (PubChem CID 8715739) has the molecular formula C23H27N3O2S and a molecular weight of 409.56 g/mol. Its IUPAC name is 2-[(5S)-3-(3-methylbutyl)-4-oxo-2-phenylimino-1,3-thiazolidin-5-yl]-N-(2-methylphenyl)acetamide.
| Compound Name | 2-[(5S)-3-(3-methylbutyl)-4-oxo-2-phenylimino-1,3-thiazolidin-5-yl]-N-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 8715739 |
| Molecular Formula | C23H27N3O2S |
| Molecular Weight | 409.56 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | 2-[(5S)-3-(3-methylbutyl)-4-oxo-2-phenylimino-1,3-thiazolidin-5-yl]-N-(2-methylphenyl)acetamide |
| SMILES | Cc1ccccc1NC(=O)C[C@@H]1S/C(=N\c2ccccc2)N(CCC(C)C)C1=O |
| InChI | InChI=1S/C23H27N3O2S/c1-16(2)13-14-26-22(28)20(29-23(26)24-18-10-5-4-6-11-18)15-21(27)25-19-12-8-7-9-17(19)3/h4-12,16,20H,13-15H2,1-3H3,(H,25,27)/b24-23-/t20-/m0/s1 |
| InChIKey | HGOPTGLFIBGDNU-NVWMPKGRSA-N |
| XLogP | 5.00 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.56 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|