C20H16Cl2N4O2S — CID 21368837
N-(2-cyanophenyl)-2-[2-(2,4-dichlorophenyl)imino-3-ethyl-4-oxo-1,3-thiazolidin-5-yl]acetamide (PubChem CID 21368837) has the molecular formula C20H16Cl2N4O2S and a molecular weight of 447.35 g/mol. Its IUPAC name is N-(2-cyanophenyl)-2-[2-(2,4-dichlorophenyl)imino-3-ethyl-4-oxo-1,3-thiazolidin-5-yl]acetamide.
| Compound Name | N-(2-cyanophenyl)-2-[2-(2,4-dichlorophenyl)imino-3-ethyl-4-oxo-1,3-thiazolidin-5-yl]acetamide |
|---|---|
| PubChem CID | 21368837 |
| Molecular Formula | C20H16Cl2N4O2S |
| Molecular Weight | 447.35 g/mol |
| Exact Mass | 446.04 |
| IUPAC Name | N-(2-cyanophenyl)-2-[2-(2,4-dichlorophenyl)imino-3-ethyl-4-oxo-1,3-thiazolidin-5-yl]acetamide |
| SMILES | CCN1C(=O)C(CC(=O)Nc2ccccc2C#N)S/C1=N\c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H16Cl2N4O2S/c1-2-26-19(28)17(10-18(27)24-15-6-4-3-5-12(15)11-23)29-20(26)25-16-8-7-13(21)9-14(16)22/h3-9,17H,2,10H2,1H3,(H,24,27)/b25-20- |
| InChIKey | BRMJDPABWGWCSO-QQTULTPQSA-N |
| XLogP | 4.85 |
| TPSA | 85.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.35 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|