C19H16BrFN4O4S — CID 21368790
2-[2-(4-bromo-2-fluorophenyl)imino-3-ethyl-4-oxo-1,3-thiazolidin-5-yl]-N-(2-nitrophenyl)acetamide (PubChem CID 21368790) has the molecular formula C19H16BrFN4O4S and a molecular weight of 495.33 g/mol. Its IUPAC name is 2-[2-(4-bromo-2-fluorophenyl)imino-3-ethyl-4-oxo-1,3-thiazolidin-5-yl]-N-(2-nitrophenyl)acetamide.
| Compound Name | 2-[2-(4-bromo-2-fluorophenyl)imino-3-ethyl-4-oxo-1,3-thiazolidin-5-yl]-N-(2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 21368790 |
| Molecular Formula | C19H16BrFN4O4S |
| Molecular Weight | 495.33 g/mol |
| Exact Mass | 494.01 |
| IUPAC Name | 2-[2-(4-bromo-2-fluorophenyl)imino-3-ethyl-4-oxo-1,3-thiazolidin-5-yl]-N-(2-nitrophenyl)acetamide |
| SMILES | CCN1C(=O)C(CC(=O)Nc2ccccc2[N+](=O)[O-])S/C1=N\c1ccc(Br)cc1F |
| InChI | InChI=1S/C19H16BrFN4O4S/c1-2-24-18(27)16(30-19(24)23-13-8-7-11(20)9-12(13)21)10-17(26)22-14-5-3-4-6-15(14)25(28)29/h3-9,16H,2,10H2,1H3,(H,22,26)/b23-19- |
| InChIKey | KSWIJHXTLPXTJZ-NMWGTECJSA-N |
| XLogP | 4.48 |
| TPSA | 104.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.33 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|