C21H22FN3O4S — CID 21368734
2-[2-(2,5-dimethoxyphenyl)imino-3-ethyl-4-oxo-1,3-thiazolidin-5-yl]-N-(2-fluorophenyl)acetamide (PubChem CID 21368734) has the molecular formula C21H22FN3O4S and a molecular weight of 431.49 g/mol. Its IUPAC name is 2-[2-(2,5-dimethoxyphenyl)imino-3-ethyl-4-oxo-1,3-thiazolidin-5-yl]-N-(2-fluorophenyl)acetamide.
| Compound Name | 2-[2-(2,5-dimethoxyphenyl)imino-3-ethyl-4-oxo-1,3-thiazolidin-5-yl]-N-(2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 21368734 |
| Molecular Formula | C21H22FN3O4S |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | 2-[2-(2,5-dimethoxyphenyl)imino-3-ethyl-4-oxo-1,3-thiazolidin-5-yl]-N-(2-fluorophenyl)acetamide |
| SMILES | CCN1C(=O)C(CC(=O)Nc2ccccc2F)S/C1=N\c1cc(OC)ccc1OC |
| InChI | InChI=1S/C21H22FN3O4S/c1-4-25-20(27)18(12-19(26)23-15-8-6-5-7-14(15)22)30-21(25)24-16-11-13(28-2)9-10-17(16)29-3/h5-11,18H,4,12H2,1-3H3,(H,23,26)/b24-21- |
| InChIKey | WZEHZWQLUKZYAT-FLFQWRMESA-N |
| XLogP | 3.82 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|