C25H24N4O4S — CID 41056673
N-(2,5-dimethoxyphenyl)-2-[(5R)-4-oxo-2-phenylimino-3-(pyridin-2-ylmethyl)-1,3-thiazolidin-5-yl]acetamide (PubChem CID 41056673) has the molecular formula C25H24N4O4S and a molecular weight of 476.56 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)-2-[(5R)-4-oxo-2-phenylimino-3-(pyridin-2-ylmethyl)-1,3-thiazolidin-5-yl]acetamide.
| Compound Name | N-(2,5-dimethoxyphenyl)-2-[(5R)-4-oxo-2-phenylimino-3-(pyridin-2-ylmethyl)-1,3-thiazolidin-5-yl]acetamide |
|---|---|
| PubChem CID | 41056673 |
| Molecular Formula | C25H24N4O4S |
| Molecular Weight | 476.56 g/mol |
| Exact Mass | 476.15 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)-2-[(5R)-4-oxo-2-phenylimino-3-(pyridin-2-ylmethyl)-1,3-thiazolidin-5-yl]acetamide |
| SMILES | COc1ccc(OC)c(NC(=O)C[C@H]2S/C(=N\c3ccccc3)N(Cc3ccccn3)C2=O)c1 |
| InChI | InChI=1S/C25H24N4O4S/c1-32-19-11-12-21(33-2)20(14-19)28-23(30)15-22-24(31)29(16-18-10-6-7-13-26-18)25(34-22)27-17-8-4-3-5-9-17/h3-14,22H,15-16H2,1-2H3,(H,28,30)/b27-25-/t22-/m1/s1 |
| InChIKey | MCXGXOIWMHRTNA-MCMRFMRISA-N |
| XLogP | 4.26 |
| TPSA | 93.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.56 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|