C23H20ClN3O4S — CID 42993693
N-(5-chloro-2-methoxyphenyl)-2-[3-(furan-2-ylmethyl)-4-oxo-2-phenylimino-1,3-thiazolidin-5-yl]acetamide (PubChem CID 42993693) has the molecular formula C23H20ClN3O4S and a molecular weight of 469.95 g/mol. Its IUPAC name is N-(5-chloro-2-methoxyphenyl)-2-[3-(furan-2-ylmethyl)-4-oxo-2-phenylimino-1,3-thiazolidin-5-yl]acetamide.
| Compound Name | N-(5-chloro-2-methoxyphenyl)-2-[3-(furan-2-ylmethyl)-4-oxo-2-phenylimino-1,3-thiazolidin-5-yl]acetamide |
|---|---|
| PubChem CID | 42993693 |
| Molecular Formula | C23H20ClN3O4S |
| Molecular Weight | 469.95 g/mol |
| Exact Mass | 469.09 |
| IUPAC Name | N-(5-chloro-2-methoxyphenyl)-2-[3-(furan-2-ylmethyl)-4-oxo-2-phenylimino-1,3-thiazolidin-5-yl]acetamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)CC1S/C(=N\c2ccccc2)N(Cc2ccco2)C1=O |
| InChI | InChI=1S/C23H20ClN3O4S/c1-30-19-10-9-15(24)12-18(19)26-21(28)13-20-22(29)27(14-17-8-5-11-31-17)23(32-20)25-16-6-3-2-4-7-16/h2-12,20H,13-14H2,1H3,(H,26,28)/b25-23- |
| InChIKey | CDRJDWHDIXGBJJ-BZZOAKBMSA-N |
| XLogP | 5.10 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.95 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|