C26H20ClN3O3S — CID 2386340
2-[(5R)-2-(4-chlorophenyl)imino-3-(furan-2-ylmethyl)-4-oxo-1,3-thiazolidin-5-yl]-N-naphthalen-2-ylacetamide (PubChem CID 2386340) has the molecular formula C26H20ClN3O3S and a molecular weight of 489.98 g/mol. Its IUPAC name is 2-[(5R)-2-(4-chlorophenyl)imino-3-(furan-2-ylmethyl)-4-oxo-1,3-thiazolidin-5-yl]-N-naphthalen-2-ylacetamide.
| Compound Name | 2-[(5R)-2-(4-chlorophenyl)imino-3-(furan-2-ylmethyl)-4-oxo-1,3-thiazolidin-5-yl]-N-naphthalen-2-ylacetamide |
|---|---|
| PubChem CID | 2386340 |
| Molecular Formula | C26H20ClN3O3S |
| Molecular Weight | 489.98 g/mol |
| Exact Mass | 489.09 |
| IUPAC Name | 2-[(5R)-2-(4-chlorophenyl)imino-3-(furan-2-ylmethyl)-4-oxo-1,3-thiazolidin-5-yl]-N-naphthalen-2-ylacetamide |
| SMILES | O=C(C[C@H]1S/C(=N\c2ccc(Cl)cc2)N(Cc2ccco2)C1=O)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C26H20ClN3O3S/c27-19-8-11-20(12-9-19)29-26-30(16-22-6-3-13-33-22)25(32)23(34-26)15-24(31)28-21-10-7-17-4-1-2-5-18(17)14-21/h1-14,23H,15-16H2,(H,28,31)/b29-26-/t23-/m1/s1 |
| InChIKey | FUHZREUSMMQOGV-SBGXGKRISA-N |
| XLogP | 6.25 |
| TPSA | 74.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.98 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|