C24H22FN3O4S — CID 42990957
2-[2-(2-ethoxyphenyl)imino-3-(furan-2-ylmethyl)-4-oxo-1,3-thiazolidin-5-yl]-N-(4-fluorophenyl)acetamide (PubChem CID 42990957) has the molecular formula C24H22FN3O4S and a molecular weight of 467.52 g/mol. Its IUPAC name is 2-[2-(2-ethoxyphenyl)imino-3-(furan-2-ylmethyl)-4-oxo-1,3-thiazolidin-5-yl]-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-[2-(2-ethoxyphenyl)imino-3-(furan-2-ylmethyl)-4-oxo-1,3-thiazolidin-5-yl]-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 42990957 |
| Molecular Formula | C24H22FN3O4S |
| Molecular Weight | 467.52 g/mol |
| Exact Mass | 467.13 |
| IUPAC Name | 2-[2-(2-ethoxyphenyl)imino-3-(furan-2-ylmethyl)-4-oxo-1,3-thiazolidin-5-yl]-N-(4-fluorophenyl)acetamide |
| SMILES | CCOc1ccccc1/N=C1\SC(CC(=O)Nc2ccc(F)cc2)C(=O)N1Cc1ccco1 |
| InChI | InChI=1S/C24H22FN3O4S/c1-2-31-20-8-4-3-7-19(20)27-24-28(15-18-6-5-13-32-18)23(30)21(33-24)14-22(29)26-17-11-9-16(25)10-12-17/h3-13,21H,2,14-15H2,1H3,(H,26,29)/b27-24- |
| InChIKey | PADVEWRSNWKREH-PNHLSOANSA-N |
| XLogP | 4.98 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.52 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|