C24H20FN3O2S — CID 17382438
2-(3-benzyl-4-oxo-2-phenylimino-1,3-thiazolidin-5-yl)-N-(4-fluorophenyl)acetamide (PubChem CID 17382438) has the molecular formula C24H20FN3O2S and a molecular weight of 433.51 g/mol. Its IUPAC name is 2-(3-benzyl-4-oxo-2-phenylimino-1,3-thiazolidin-5-yl)-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-(3-benzyl-4-oxo-2-phenylimino-1,3-thiazolidin-5-yl)-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 17382438 |
| Molecular Formula | C24H20FN3O2S |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | 2-(3-benzyl-4-oxo-2-phenylimino-1,3-thiazolidin-5-yl)-N-(4-fluorophenyl)acetamide |
| SMILES | O=C(CC1S/C(=N\c2ccccc2)N(Cc2ccccc2)C1=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C24H20FN3O2S/c25-18-11-13-20(14-12-18)26-22(29)15-21-23(30)28(16-17-7-3-1-4-8-17)24(31-21)27-19-9-5-2-6-10-19/h1-14,21H,15-16H2,(H,26,29)/b27-24- |
| InChIKey | HJWRJSQEZLGLPT-PNHLSOANSA-N |
| XLogP | 4.99 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|