C24H19ClFN3O2S — CID 41245307
2-[(5R)-3-benzyl-2-(4-fluorophenyl)imino-4-oxo-1,3-thiazolidin-5-yl]-N-(3-chlorophenyl)acetamide (PubChem CID 41245307) has the molecular formula C24H19ClFN3O2S and a molecular weight of 467.95 g/mol. Its IUPAC name is 2-[(5R)-3-benzyl-2-(4-fluorophenyl)imino-4-oxo-1,3-thiazolidin-5-yl]-N-(3-chlorophenyl)acetamide.
| Compound Name | 2-[(5R)-3-benzyl-2-(4-fluorophenyl)imino-4-oxo-1,3-thiazolidin-5-yl]-N-(3-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 41245307 |
| Molecular Formula | C24H19ClFN3O2S |
| Molecular Weight | 467.95 g/mol |
| Exact Mass | 467.09 |
| IUPAC Name | 2-[(5R)-3-benzyl-2-(4-fluorophenyl)imino-4-oxo-1,3-thiazolidin-5-yl]-N-(3-chlorophenyl)acetamide |
| SMILES | O=C(C[C@H]1S/C(=N\c2ccc(F)cc2)N(Cc2ccccc2)C1=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C24H19ClFN3O2S/c25-17-7-4-8-20(13-17)27-22(30)14-21-23(31)29(15-16-5-2-1-3-6-16)24(32-21)28-19-11-9-18(26)10-12-19/h1-13,21H,14-15H2,(H,27,30)/b28-24-/t21-/m1/s1 |
| InChIKey | TUICPCICFWRFJZ-OKPNVDCHSA-N |
| XLogP | 5.64 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.95 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|