C27H24F3N3O3S — CID 98307888
2-[(5S)-3-benzyl-4-oxo-2-[4-(trifluoromethyl)phenyl]imino-1,3-thiazolidin-5-yl]-N-(3-ethoxyphenyl)acetamide (PubChem CID 98307888) has the molecular formula C27H24F3N3O3S and a molecular weight of 527.57 g/mol. Its IUPAC name is 2-[(5S)-3-benzyl-4-oxo-2-[4-(trifluoromethyl)phenyl]imino-1,3-thiazolidin-5-yl]-N-(3-ethoxyphenyl)acetamide.
| Compound Name | 2-[(5S)-3-benzyl-4-oxo-2-[4-(trifluoromethyl)phenyl]imino-1,3-thiazolidin-5-yl]-N-(3-ethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 98307888 |
| Molecular Formula | C27H24F3N3O3S |
| Molecular Weight | 527.57 g/mol |
| Exact Mass | 527.15 |
| IUPAC Name | 2-[(5S)-3-benzyl-4-oxo-2-[4-(trifluoromethyl)phenyl]imino-1,3-thiazolidin-5-yl]-N-(3-ethoxyphenyl)acetamide |
| SMILES | CCOc1cccc(NC(=O)C[C@@H]2S/C(=N\c3ccc(C(F)(F)F)cc3)N(Cc3ccccc3)C2=O)c1 |
| InChI | InChI=1S/C27H24F3N3O3S/c1-2-36-22-10-6-9-21(15-22)31-24(34)16-23-25(35)33(17-18-7-4-3-5-8-18)26(37-23)32-20-13-11-19(12-14-20)27(28,29)30/h3-15,23H,2,16-17H2,1H3,(H,31,34)/b32-26-/t23-/m0/s1 |
| InChIKey | VZPVOKGSOIKGEZ-HFBYFEGMSA-N |
| XLogP | 6.26 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.57 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|