C27H25N3O5S — CID 41242479
2-[(5R)-3-(1,3-benzodioxol-5-ylmethyl)-2-(4-ethoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]-N-phenylacetamide (PubChem CID 41242479) has the molecular formula C27H25N3O5S and a molecular weight of 503.58 g/mol. Its IUPAC name is 2-[(5R)-3-(1,3-benzodioxol-5-ylmethyl)-2-(4-ethoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]-N-phenylacetamide.
| Compound Name | 2-[(5R)-3-(1,3-benzodioxol-5-ylmethyl)-2-(4-ethoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 41242479 |
| Molecular Formula | C27H25N3O5S |
| Molecular Weight | 503.58 g/mol |
| Exact Mass | 503.15 |
| IUPAC Name | 2-[(5R)-3-(1,3-benzodioxol-5-ylmethyl)-2-(4-ethoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]-N-phenylacetamide |
| SMILES | CCOc1ccc(/N=C2\S[C@H](CC(=O)Nc3ccccc3)C(=O)N2Cc2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C27H25N3O5S/c1-2-33-21-11-9-20(10-12-21)29-27-30(16-18-8-13-22-23(14-18)35-17-34-22)26(32)24(36-27)15-25(31)28-19-6-4-3-5-7-19/h3-14,24H,2,15-17H2,1H3,(H,28,31)/b29-27-/t24-/m1/s1 |
| InChIKey | GEDUGJMUZCSCOD-MLNTVTBVSA-N |
| XLogP | 4.97 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.58 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|