C27H25N3O4S — CID 41242631
ethyl 4-[[(5R)-5-(2-anilino-2-oxoethyl)-3-benzyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate (PubChem CID 41242631) has the molecular formula C27H25N3O4S and a molecular weight of 487.58 g/mol. Its IUPAC name is ethyl 4-[[(5R)-5-(2-anilino-2-oxoethyl)-3-benzyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate.
| Compound Name | ethyl 4-[[(5R)-5-(2-anilino-2-oxoethyl)-3-benzyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
|---|---|
| PubChem CID | 41242631 |
| Molecular Formula | C27H25N3O4S |
| Molecular Weight | 487.58 g/mol |
| Exact Mass | 487.16 |
| IUPAC Name | ethyl 4-[[(5R)-5-(2-anilino-2-oxoethyl)-3-benzyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(/N=C2\S[C@H](CC(=O)Nc3ccccc3)C(=O)N2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C27H25N3O4S/c1-2-34-26(33)20-13-15-22(16-14-20)29-27-30(18-19-9-5-3-6-10-19)25(32)23(35-27)17-24(31)28-21-11-7-4-8-12-21/h3-16,23H,2,17-18H2,1H3,(H,28,31)/b29-27-/t23-/m1/s1 |
| InChIKey | QMWWGGHNBKEPDL-JIDDHEAESA-N |
| XLogP | 5.02 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.58 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|