C28H25N3O6S — CID 98074666
4-[[(6S)-3-benzyl-2-(4-ethoxycarbonylphenyl)imino-4-oxo-1,3-thiazinane-6-carbonyl]amino]benzoic acid (PubChem CID 98074666) has the molecular formula C28H25N3O6S and a molecular weight of 531.59 g/mol. Its IUPAC name is 4-[[(6S)-3-benzyl-2-(4-ethoxycarbonylphenyl)imino-4-oxo-1,3-thiazinane-6-carbonyl]amino]benzoic acid.
| Compound Name | 4-[[(6S)-3-benzyl-2-(4-ethoxycarbonylphenyl)imino-4-oxo-1,3-thiazinane-6-carbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 98074666 |
| Molecular Formula | C28H25N3O6S |
| Molecular Weight | 531.59 g/mol |
| Exact Mass | 531.15 |
| IUPAC Name | 4-[[(6S)-3-benzyl-2-(4-ethoxycarbonylphenyl)imino-4-oxo-1,3-thiazinane-6-carbonyl]amino]benzoic acid |
| SMILES | CCOC(=O)c1ccc(/N=C2\S[C@H](C(=O)Nc3ccc(C(=O)O)cc3)CC(=O)N2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C28H25N3O6S/c1-2-37-27(36)20-10-14-22(15-11-20)30-28-31(17-18-6-4-3-5-7-18)24(32)16-23(38-28)25(33)29-21-12-8-19(9-13-21)26(34)35/h3-15,23H,2,16-17H2,1H3,(H,29,33)(H,34,35)/b30-28-/t23-/m0/s1 |
| InChIKey | NBDMBVGEEOZLFY-UFTYEHDASA-N |
| XLogP | 4.72 |
| TPSA | 125.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.59 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|