C27H23ClIN3O4S — CID 5019937
ethyl 4-[[3-[(2-chlorophenyl)methyl]-6-[(4-iodophenyl)carbamoyl]-4-oxo-1,3-thiazinan-2-ylidene]amino]benzoate (PubChem CID 5019937) has the molecular formula C27H23ClIN3O4S and a molecular weight of 647.92 g/mol. Its IUPAC name is ethyl 4-[[3-[(2-chlorophenyl)methyl]-6-[(4-iodophenyl)carbamoyl]-4-oxo-1,3-thiazinan-2-ylidene]amino]benzoate.
| Compound Name | ethyl 4-[[3-[(2-chlorophenyl)methyl]-6-[(4-iodophenyl)carbamoyl]-4-oxo-1,3-thiazinan-2-ylidene]amino]benzoate |
|---|---|
| PubChem CID | 5019937 |
| Molecular Formula | C27H23ClIN3O4S |
| Molecular Weight | 647.92 g/mol |
| Exact Mass | 647.01 |
| IUPAC Name | ethyl 4-[[3-[(2-chlorophenyl)methyl]-6-[(4-iodophenyl)carbamoyl]-4-oxo-1,3-thiazinan-2-ylidene]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(/N=C2\SC(C(=O)Nc3ccc(I)cc3)CC(=O)N2Cc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C27H23ClIN3O4S/c1-2-36-26(35)17-7-11-21(12-8-17)31-27-32(16-18-5-3-4-6-22(18)28)24(33)15-23(37-27)25(34)30-20-13-9-19(29)10-14-20/h3-14,23H,2,15-16H2,1H3,(H,30,34)/b31-27- |
| InChIKey | LJTXAFQVSJGKKQ-QVTSOHHYSA-N |
| XLogP | 6.28 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.92 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|