C30H30ClN3O5S — CID 5142716
ethyl 4-[[3-[(2-chlorophenyl)methyl]-4-oxo-6-[(4-propoxyphenyl)carbamoyl]-1,3-thiazinan-2-ylidene]amino]benzoate (PubChem CID 5142716) has the molecular formula C30H30ClN3O5S and a molecular weight of 580.11 g/mol. Its IUPAC name is ethyl 4-[[3-[(2-chlorophenyl)methyl]-4-oxo-6-[(4-propoxyphenyl)carbamoyl]-1,3-thiazinan-2-ylidene]amino]benzoate.
| Compound Name | ethyl 4-[[3-[(2-chlorophenyl)methyl]-4-oxo-6-[(4-propoxyphenyl)carbamoyl]-1,3-thiazinan-2-ylidene]amino]benzoate |
|---|---|
| PubChem CID | 5142716 |
| Molecular Formula | C30H30ClN3O5S |
| Molecular Weight | 580.11 g/mol |
| Exact Mass | 579.16 |
| IUPAC Name | ethyl 4-[[3-[(2-chlorophenyl)methyl]-4-oxo-6-[(4-propoxyphenyl)carbamoyl]-1,3-thiazinan-2-ylidene]amino]benzoate |
| SMILES | CCCOc1ccc(NC(=O)C2CC(=O)N(Cc3ccccc3Cl)/C(=N/c3ccc(C(=O)OCC)cc3)S2)cc1 |
| InChI | InChI=1S/C30H30ClN3O5S/c1-3-17-39-24-15-13-22(14-16-24)32-28(36)26-18-27(35)34(19-21-7-5-6-8-25(21)31)30(40-26)33-23-11-9-20(10-12-23)29(37)38-4-2/h5-16,26H,3-4,17-19H2,1-2H3,(H,32,36)/b33-30- |
| InChIKey | HNPLAQPEHZFZIN-MEIHLTSWSA-N |
| XLogP | 6.47 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.11 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|