C27H24BrN3O4S — CID 3435805
ethyl 4-[[3-benzyl-6-[(4-bromophenyl)carbamoyl]-4-oxo-1,3-thiazinan-2-ylidene]amino]benzoate (PubChem CID 3435805) has the molecular formula C27H24BrN3O4S and a molecular weight of 566.48 g/mol. Its IUPAC name is ethyl 4-[[3-benzyl-6-[(4-bromophenyl)carbamoyl]-4-oxo-1,3-thiazinan-2-ylidene]amino]benzoate.
| Compound Name | ethyl 4-[[3-benzyl-6-[(4-bromophenyl)carbamoyl]-4-oxo-1,3-thiazinan-2-ylidene]amino]benzoate |
|---|---|
| PubChem CID | 3435805 |
| Molecular Formula | C27H24BrN3O4S |
| Molecular Weight | 566.48 g/mol |
| Exact Mass | 565.07 |
| IUPAC Name | ethyl 4-[[3-benzyl-6-[(4-bromophenyl)carbamoyl]-4-oxo-1,3-thiazinan-2-ylidene]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(/N=C2\SC(C(=O)Nc3ccc(Br)cc3)CC(=O)N2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C27H24BrN3O4S/c1-2-35-26(34)19-8-12-22(13-9-19)30-27-31(17-18-6-4-3-5-7-18)24(32)16-23(36-27)25(33)29-21-14-10-20(28)11-15-21/h3-15,23H,2,16-17H2,1H3,(H,29,33)/b30-27- |
| InChIKey | BOWKVYCCDOPXOG-IKPAITLHSA-N |
| XLogP | 5.79 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.48 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|