C30H30BrN3O6S — CID 4588527
ethyl 4-[[6-[(4-bromophenyl)carbamoyl]-3-[2-(3,4-dimethoxyphenyl)ethyl]-4-oxo-1,3-thiazinan-2-ylidene]amino]benzoate (PubChem CID 4588527) has the molecular formula C30H30BrN3O6S and a molecular weight of 640.56 g/mol. Its IUPAC name is ethyl 4-[[6-[(4-bromophenyl)carbamoyl]-3-[2-(3,4-dimethoxyphenyl)ethyl]-4-oxo-1,3-thiazinan-2-ylidene]amino]benzoate.
| Compound Name | ethyl 4-[[6-[(4-bromophenyl)carbamoyl]-3-[2-(3,4-dimethoxyphenyl)ethyl]-4-oxo-1,3-thiazinan-2-ylidene]amino]benzoate |
|---|---|
| PubChem CID | 4588527 |
| Molecular Formula | C30H30BrN3O6S |
| Molecular Weight | 640.56 g/mol |
| Exact Mass | 639.10 |
| IUPAC Name | ethyl 4-[[6-[(4-bromophenyl)carbamoyl]-3-[2-(3,4-dimethoxyphenyl)ethyl]-4-oxo-1,3-thiazinan-2-ylidene]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(/N=C2\SC(C(=O)Nc3ccc(Br)cc3)CC(=O)N2CCc2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C30H30BrN3O6S/c1-4-40-29(37)20-6-10-23(11-7-20)33-30-34(16-15-19-5-14-24(38-2)25(17-19)39-3)27(35)18-26(41-30)28(36)32-22-12-8-21(31)9-13-22/h5-14,17,26H,4,15-16,18H2,1-3H3,(H,32,36)/b33-30- |
| InChIKey | RTXDVSBYNFTKRV-MEIHLTSWSA-N |
| XLogP | 5.85 |
| TPSA | 106.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.56 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|