C29H27Cl2N3O5S — CID 4008348
ethyl 4-[[6-[(3,5-dichlorophenyl)carbamoyl]-3-[2-(4-methoxyphenyl)ethyl]-4-oxo-1,3-thiazinan-2-ylidene]amino]benzoate (PubChem CID 4008348) has the molecular formula C29H27Cl2N3O5S and a molecular weight of 600.52 g/mol. Its IUPAC name is ethyl 4-[[6-[(3,5-dichlorophenyl)carbamoyl]-3-[2-(4-methoxyphenyl)ethyl]-4-oxo-1,3-thiazinan-2-ylidene]amino]benzoate.
| Compound Name | ethyl 4-[[6-[(3,5-dichlorophenyl)carbamoyl]-3-[2-(4-methoxyphenyl)ethyl]-4-oxo-1,3-thiazinan-2-ylidene]amino]benzoate |
|---|---|
| PubChem CID | 4008348 |
| Molecular Formula | C29H27Cl2N3O5S |
| Molecular Weight | 600.52 g/mol |
| Exact Mass | 599.10 |
| IUPAC Name | ethyl 4-[[6-[(3,5-dichlorophenyl)carbamoyl]-3-[2-(4-methoxyphenyl)ethyl]-4-oxo-1,3-thiazinan-2-ylidene]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(/N=C2\SC(C(=O)Nc3cc(Cl)cc(Cl)c3)CC(=O)N2CCc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C29H27Cl2N3O5S/c1-3-39-28(37)19-6-8-22(9-7-19)33-29-34(13-12-18-4-10-24(38-2)11-5-18)26(35)17-25(40-29)27(36)32-23-15-20(30)14-21(31)16-23/h4-11,14-16,25H,3,12-13,17H2,1-2H3,(H,32,36)/b33-29- |
| InChIKey | VJGCNQDRQGPRAU-IYOYZZHUSA-N |
| XLogP | 6.38 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.52 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|