C27H26ClN3O4S — CID 41201343
(6R)-3-[2-(4-chlorophenyl)ethyl]-N-(4-methoxyphenyl)-2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazinane-6-carboxamide (PubChem CID 41201343) has the molecular formula C27H26ClN3O4S and a molecular weight of 524.04 g/mol. Its IUPAC name is (6R)-3-[2-(4-chlorophenyl)ethyl]-N-(4-methoxyphenyl)-2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazinane-6-carboxamide.
| Compound Name | (6R)-3-[2-(4-chlorophenyl)ethyl]-N-(4-methoxyphenyl)-2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 41201343 |
| Molecular Formula | C27H26ClN3O4S |
| Molecular Weight | 524.04 g/mol |
| Exact Mass | 523.13 |
| IUPAC Name | (6R)-3-[2-(4-chlorophenyl)ethyl]-N-(4-methoxyphenyl)-2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazinane-6-carboxamide |
| SMILES | COc1ccc(/N=C2\S[C@@H](C(=O)Nc3ccc(OC)cc3)CC(=O)N2CCc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C27H26ClN3O4S/c1-34-22-11-7-20(8-12-22)29-26(33)24-17-25(32)31(16-15-18-3-5-19(28)6-4-18)27(36-24)30-21-9-13-23(35-2)14-10-21/h3-14,24H,15-17H2,1-2H3,(H,29,33)/b30-27-/t24-/m1/s1 |
| InChIKey | JFBPWXMZBRWWLZ-FJOMVMCCSA-N |
| XLogP | 5.56 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.04 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|