C25H20Cl3N3O2S — CID 3503999
N-(4-chlorophenyl)-3-[2-(4-chlorophenyl)ethyl]-2-(4-chlorophenyl)imino-4-oxo-1,3-thiazinane-6-carboxamide (PubChem CID 3503999) has the molecular formula C25H20Cl3N3O2S and a molecular weight of 532.88 g/mol. Its IUPAC name is N-(4-chlorophenyl)-3-[2-(4-chlorophenyl)ethyl]-2-(4-chlorophenyl)imino-4-oxo-1,3-thiazinane-6-carboxamide.
| Compound Name | N-(4-chlorophenyl)-3-[2-(4-chlorophenyl)ethyl]-2-(4-chlorophenyl)imino-4-oxo-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 3503999 |
| Molecular Formula | C25H20Cl3N3O2S |
| Molecular Weight | 532.88 g/mol |
| Exact Mass | 531.03 |
| IUPAC Name | N-(4-chlorophenyl)-3-[2-(4-chlorophenyl)ethyl]-2-(4-chlorophenyl)imino-4-oxo-1,3-thiazinane-6-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1)C1CC(=O)N(CCc2ccc(Cl)cc2)/C(=N/c2ccc(Cl)cc2)S1 |
| InChI | InChI=1S/C25H20Cl3N3O2S/c26-17-3-1-16(2-4-17)13-14-31-23(32)15-22(24(33)29-20-9-5-18(27)6-10-20)34-25(31)30-21-11-7-19(28)8-12-21/h1-12,22H,13-15H2,(H,29,33)/b30-25- |
| InChIKey | TWBQBJBJVCJTDC-JVCXMKTPSA-N |
| XLogP | 6.85 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.88 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|