C26H23BrClN3O2S — CID 3635145
N-(4-bromophenyl)-2-(4-chlorophenyl)imino-4-oxo-3-(3-phenylpropyl)-1,3-thiazinane-6-carboxamide (PubChem CID 3635145) has the molecular formula C26H23BrClN3O2S and a molecular weight of 556.91 g/mol. Its IUPAC name is N-(4-bromophenyl)-2-(4-chlorophenyl)imino-4-oxo-3-(3-phenylpropyl)-1,3-thiazinane-6-carboxamide.
| Compound Name | N-(4-bromophenyl)-2-(4-chlorophenyl)imino-4-oxo-3-(3-phenylpropyl)-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 3635145 |
| Molecular Formula | C26H23BrClN3O2S |
| Molecular Weight | 556.91 g/mol |
| Exact Mass | 555.04 |
| IUPAC Name | N-(4-bromophenyl)-2-(4-chlorophenyl)imino-4-oxo-3-(3-phenylpropyl)-1,3-thiazinane-6-carboxamide |
| SMILES | O=C(Nc1ccc(Br)cc1)C1CC(=O)N(CCCc2ccccc2)/C(=N/c2ccc(Cl)cc2)S1 |
| InChI | InChI=1S/C26H23BrClN3O2S/c27-19-8-12-21(13-9-19)29-25(33)23-17-24(32)31(16-4-7-18-5-2-1-3-6-18)26(34-23)30-22-14-10-20(28)11-15-22/h1-3,5-6,8-15,23H,4,7,16-17H2,(H,29,33)/b30-26- |
| InChIKey | BKASXGGOMVXYMC-BXVZCJGGSA-N |
| XLogP | 6.70 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.91 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|