C25H21Cl2N3O2S — CID 46497506
2-(3,5-dichlorophenyl)imino-4-oxo-N-phenyl-3-(2-phenylethyl)-1,3-thiazinane-6-carboxamide (PubChem CID 46497506) has the molecular formula C25H21Cl2N3O2S and a molecular weight of 498.44 g/mol. Its IUPAC name is 2-(3,5-dichlorophenyl)imino-4-oxo-N-phenyl-3-(2-phenylethyl)-1,3-thiazinane-6-carboxamide.
| Compound Name | 2-(3,5-dichlorophenyl)imino-4-oxo-N-phenyl-3-(2-phenylethyl)-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 46497506 |
| Molecular Formula | C25H21Cl2N3O2S |
| Molecular Weight | 498.44 g/mol |
| Exact Mass | 497.07 |
| IUPAC Name | 2-(3,5-dichlorophenyl)imino-4-oxo-N-phenyl-3-(2-phenylethyl)-1,3-thiazinane-6-carboxamide |
| SMILES | O=C(Nc1ccccc1)C1CC(=O)N(CCc2ccccc2)/C(=N/c2cc(Cl)cc(Cl)c2)S1 |
| InChI | InChI=1S/C25H21Cl2N3O2S/c26-18-13-19(27)15-21(14-18)29-25-30(12-11-17-7-3-1-4-8-17)23(31)16-22(33-25)24(32)28-20-9-5-2-6-10-20/h1-10,13-15,22H,11-12,16H2,(H,28,32)/b29-25- |
| InChIKey | IELILCZZIBRGPU-GNVQSUKOSA-N |
| XLogP | 6.20 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.44 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|