C25H20ClF2N3O2S — CID 42591076
(6S)-2-(4-chlorophenyl)imino-N-(4-fluorophenyl)-3-[2-(4-fluorophenyl)ethyl]-4-oxo-1,3-thiazinane-6-carboxamide (PubChem CID 42591076) has the molecular formula C25H20ClF2N3O2S and a molecular weight of 499.97 g/mol. Its IUPAC name is (6S)-2-(4-chlorophenyl)imino-N-(4-fluorophenyl)-3-[2-(4-fluorophenyl)ethyl]-4-oxo-1,3-thiazinane-6-carboxamide.
| Compound Name | (6S)-2-(4-chlorophenyl)imino-N-(4-fluorophenyl)-3-[2-(4-fluorophenyl)ethyl]-4-oxo-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 42591076 |
| Molecular Formula | C25H20ClF2N3O2S |
| Molecular Weight | 499.97 g/mol |
| Exact Mass | 499.09 |
| IUPAC Name | (6S)-2-(4-chlorophenyl)imino-N-(4-fluorophenyl)-3-[2-(4-fluorophenyl)ethyl]-4-oxo-1,3-thiazinane-6-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1)[C@@H]1CC(=O)N(CCc2ccc(F)cc2)/C(=N/c2ccc(Cl)cc2)S1 |
| InChI | InChI=1S/C25H20ClF2N3O2S/c26-17-3-9-21(10-4-17)30-25-31(14-13-16-1-5-18(27)6-2-16)23(32)15-22(34-25)24(33)29-20-11-7-19(28)8-12-20/h1-12,22H,13-15H2,(H,29,33)/b30-25-/t22-/m0/s1 |
| InChIKey | BUFNANQUHOCUTI-XNTIDICGSA-N |
| XLogP | 5.82 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.97 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|