C28H28FN3O4S — CID 3638157
N-(4-ethoxyphenyl)-2-(4-fluorophenyl)imino-3-[2-(4-methoxyphenyl)ethyl]-4-oxo-1,3-thiazinane-6-carboxamide (PubChem CID 3638157) has the molecular formula C28H28FN3O4S and a molecular weight of 521.61 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-2-(4-fluorophenyl)imino-3-[2-(4-methoxyphenyl)ethyl]-4-oxo-1,3-thiazinane-6-carboxamide.
| Compound Name | N-(4-ethoxyphenyl)-2-(4-fluorophenyl)imino-3-[2-(4-methoxyphenyl)ethyl]-4-oxo-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 3638157 |
| Molecular Formula | C28H28FN3O4S |
| Molecular Weight | 521.61 g/mol |
| Exact Mass | 521.18 |
| IUPAC Name | N-(4-ethoxyphenyl)-2-(4-fluorophenyl)imino-3-[2-(4-methoxyphenyl)ethyl]-4-oxo-1,3-thiazinane-6-carboxamide |
| SMILES | CCOc1ccc(NC(=O)C2CC(=O)N(CCc3ccc(OC)cc3)/C(=N/c3ccc(F)cc3)S2)cc1 |
| InChI | InChI=1S/C28H28FN3O4S/c1-3-36-24-14-10-21(11-15-24)30-27(34)25-18-26(33)32(17-16-19-4-12-23(35-2)13-5-19)28(37-25)31-22-8-6-20(29)7-9-22/h4-15,25H,3,16-18H2,1-2H3,(H,30,34)/b31-28- |
| InChIKey | XNQQMHWXNWJIHY-PNOGMODKSA-N |
| XLogP | 5.44 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.61 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|