C30H31N3O6S — CID 3478988
ethyl 4-[[3-[2-(4-methoxyphenyl)ethyl]-2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazinane-6-carbonyl]amino]benzoate (PubChem CID 3478988) has the molecular formula C30H31N3O6S and a molecular weight of 561.66 g/mol. Its IUPAC name is ethyl 4-[[3-[2-(4-methoxyphenyl)ethyl]-2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazinane-6-carbonyl]amino]benzoate.
| Compound Name | ethyl 4-[[3-[2-(4-methoxyphenyl)ethyl]-2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazinane-6-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 3478988 |
| Molecular Formula | C30H31N3O6S |
| Molecular Weight | 561.66 g/mol |
| Exact Mass | 561.19 |
| IUPAC Name | ethyl 4-[[3-[2-(4-methoxyphenyl)ethyl]-2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazinane-6-carbonyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)C2CC(=O)N(CCc3ccc(OC)cc3)/C(=N/c3ccc(OC)cc3)S2)cc1 |
| InChI | InChI=1S/C30H31N3O6S/c1-4-39-29(36)21-7-9-22(10-8-21)31-28(35)26-19-27(34)33(18-17-20-5-13-24(37-2)14-6-20)30(40-26)32-23-11-15-25(38-3)16-12-23/h5-16,26H,4,17-19H2,1-3H3,(H,31,35)/b32-30- |
| InChIKey | BNIBPDABFCPYER-GCUVURNUSA-N |
| XLogP | 5.08 |
| TPSA | 106.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.66 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|